C18H17NO4 — CID 27444483
phenyl 2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetate (PubChem CID 27444483) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is phenyl 2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetate.
| Compound Name | phenyl 2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 27444483 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | phenyl 2-[4-(2-oxopyrrolidin-1-yl)phenoxy]acetate |
| SMILES | O=C(COc1ccc(N2CCCC2=O)cc1)Oc1ccccc1 |
| InChI | InChI=1S/C18H17NO4/c20-17-7-4-12-19(17)14-8-10-15(11-9-14)22-13-18(21)23-16-5-2-1-3-6-16/h1-3,5-6,8-11H,4,7,12-13H2 |
| InChIKey | GSDABEMKEVTOLV-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|