C18H15Cl2NO3 — CID 35544576
[4-(2-oxopyrrolidin-1-yl)phenyl] 2-(2,6-dichlorophenyl)acetate (PubChem CID 35544576) has the molecular formula C18H15Cl2NO3 and a molecular weight of 364.23 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(2,6-dichlorophenyl)acetate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(2,6-dichlorophenyl)acetate |
|---|---|
| PubChem CID | 35544576 |
| Molecular Formula | C18H15Cl2NO3 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-(2,6-dichlorophenyl)acetate |
| SMILES | O=C(Cc1c(Cl)cccc1Cl)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C18H15Cl2NO3/c19-15-3-1-4-16(20)14(15)11-18(23)24-13-8-6-12(7-9-13)21-10-2-5-17(21)22/h1,3-4,6-9H,2,5,10-11H2 |
| InChIKey | WGAXXIARFLBOOS-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|