C20H16ClN3O3 — CID 51114000
[4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylate (PubChem CID 51114000) has the molecular formula C20H16ClN3O3 and a molecular weight of 381.82 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylate |
|---|---|
| PubChem CID | 51114000 |
| Molecular Formula | C20H16ClN3O3 |
| Molecular Weight | 381.82 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 3-(2-chlorophenyl)-1H-pyrazole-5-carboxylate |
| SMILES | O=C(Oc1ccc(N2CCCC2=O)cc1)c1cc(-c2ccccc2Cl)n[nH]1 |
| InChI | InChI=1S/C20H16ClN3O3/c21-16-5-2-1-4-15(16)17-12-18(23-22-17)20(26)27-14-9-7-13(8-10-14)24-11-3-6-19(24)25/h1-2,4-5,7-10,12H,3,6,11H2,(H,22,23) |
| InChIKey | FKJGCHMGSDJWPP-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.82 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|