C21H17FN2O3S — CID 35545507
[4-(2-oxopyrrolidin-1-yl)phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 35545507) has the molecular formula C21H17FN2O3S and a molecular weight of 396.44 g/mol. Its IUPAC name is [4-(2-oxopyrrolidin-1-yl)phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 35545507 |
| Molecular Formula | C21H17FN2O3S |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.09 |
| IUPAC Name | [4-(2-oxopyrrolidin-1-yl)phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | O=C(Cc1csc(-c2ccc(F)cc2)n1)Oc1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H17FN2O3S/c22-15-5-3-14(4-6-15)21-23-16(13-28-21)12-20(26)27-18-9-7-17(8-10-18)24-11-1-2-19(24)25/h3-10,13H,1-2,11-12H2 |
| InChIKey | OYJMQHKJAVWQIE-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|