C24H19FN2O4S2 — CID 16557201
[4-[benzenesulfonyl(methyl)amino]phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 16557201) has the molecular formula C24H19FN2O4S2 and a molecular weight of 482.56 g/mol. Its IUPAC name is [4-[benzenesulfonyl(methyl)amino]phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 16557201 |
| Molecular Formula | C24H19FN2O4S2 |
| Molecular Weight | 482.56 g/mol |
| Exact Mass | 482.08 |
| IUPAC Name | [4-[benzenesulfonyl(methyl)amino]phenyl] 2-[2-(4-fluorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CN(c1ccc(OC(=O)Cc2csc(-c3ccc(F)cc3)n2)cc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H19FN2O4S2/c1-27(33(29,30)22-5-3-2-4-6-22)20-11-13-21(14-12-20)31-23(28)15-19-16-32-24(26-19)17-7-9-18(25)10-8-17/h2-14,16H,15H2,1H3 |
| InChIKey | HPQNUIWMLATOQE-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.56 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|