C17H12ClNO2S — CID 8764496
(4-chlorophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate (PubChem CID 8764496) has the molecular formula C17H12ClNO2S and a molecular weight of 329.81 g/mol. Its IUPAC name is (4-chlorophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-chlorophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 8764496 |
| Molecular Formula | C17H12ClNO2S |
| Molecular Weight | 329.81 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (4-chlorophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2ccccc2)n1)Oc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H12ClNO2S/c18-13-6-8-15(9-7-13)21-16(20)10-14-11-22-17(19-14)12-4-2-1-3-5-12/h1-9,11H,10H2 |
| InChIKey | RSSRRUMSRKNOSV-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.81 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|