C19H14ClNO3S — CID 9191780
(4-acetylphenyl) 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 9191780) has the molecular formula C19H14ClNO3S and a molecular weight of 371.85 g/mol. Its IUPAC name is (4-acetylphenyl) 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (4-acetylphenyl) 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 9191780 |
| Molecular Formula | C19H14ClNO3S |
| Molecular Weight | 371.85 g/mol |
| Exact Mass | 371.04 |
| IUPAC Name | (4-acetylphenyl) 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | CC(=O)c1ccc(OC(=O)Cc2csc(-c3ccccc3Cl)n2)cc1 |
| InChI | InChI=1S/C19H14ClNO3S/c1-12(22)13-6-8-15(9-7-13)24-18(23)10-14-11-25-19(21-14)16-4-2-3-5-17(16)20/h2-9,11H,10H2,1H3 |
| InChIKey | WXKWAQIGALDIFQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.85 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|