C12H11ClN2O2S — CID 51279381
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-methoxyacetamide (PubChem CID 51279381) has the molecular formula C12H11ClN2O2S and a molecular weight of 282.75 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-methoxyacetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-methoxyacetamide |
|---|---|
| PubChem CID | 51279381 |
| Molecular Formula | C12H11ClN2O2S |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.02 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-methoxyacetamide |
| SMILES | CONC(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C12H11ClN2O2S/c1-17-15-11(16)6-8-7-18-12(14-8)9-4-2-3-5-10(9)13/h2-5,7H,6H2,1H3,(H,15,16) |
| InChIKey | DIQWMQZOGZTHFD-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|