C14H16ClN3OS — CID 119406639
N-(3-aminopropyl)-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 119406639) has the molecular formula C14H16ClN3OS and a molecular weight of 309.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(3-aminopropyl)-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 119406639 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | N-(3-aminopropyl)-2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | NCCCNC(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H16ClN3OS/c15-12-5-2-1-4-11(12)14-18-10(9-20-14)8-13(19)17-7-3-6-16/h1-2,4-5,9H,3,6-8,16H2,(H,17,19) |
| InChIKey | OBPFTCQFRHTSJX-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|