C20H19ClN2OS — CID 9457086
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[(2S)-2-phenylpropyl]acetamide (PubChem CID 9457086) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[(2S)-2-phenylpropyl]acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[(2S)-2-phenylpropyl]acetamide |
|---|---|
| PubChem CID | 9457086 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N-[(2S)-2-phenylpropyl]acetamide |
| SMILES | C[C@H](CNC(=O)Cc1csc(-c2ccccc2Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C20H19ClN2OS/c1-14(15-7-3-2-4-8-15)12-22-19(24)11-16-13-25-20(23-16)17-9-5-6-10-18(17)21/h2-10,13-14H,11-12H2,1H3,(H,22,24)/t14-/m1/s1 |
| InChIKey | CNIIFSZQPOPGPK-CQSZACIVSA-N |
| XLogP | 4.93 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |