C14H12ClNO2S — CID 134055357
prop-2-enyl 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 134055357) has the molecular formula C14H12ClNO2S and a molecular weight of 293.78 g/mol. Its IUPAC name is prop-2-enyl 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | prop-2-enyl 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 134055357 |
| Molecular Formula | C14H12ClNO2S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | prop-2-enyl 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | C=CCOC(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C14H12ClNO2S/c1-2-7-18-13(17)8-10-9-19-14(16-10)11-5-3-4-6-12(11)15/h2-6,9H,1,7-8H2 |
| InChIKey | KWZOTHDTETVINL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|