C15H11ClN4OS — CID 52827861
2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N,N-bis(cyanomethyl)acetamide (PubChem CID 52827861) has the molecular formula C15H11ClN4OS and a molecular weight of 330.80 g/mol. Its IUPAC name is 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N,N-bis(cyanomethyl)acetamide.
| Compound Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N,N-bis(cyanomethyl)acetamide |
|---|---|
| PubChem CID | 52827861 |
| Molecular Formula | C15H11ClN4OS |
| Molecular Weight | 330.80 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | 2-[2-(2-chlorophenyl)-1,3-thiazol-4-yl]-N,N-bis(cyanomethyl)acetamide |
| SMILES | N#CCN(CC#N)C(=O)Cc1csc(-c2ccccc2Cl)n1 |
| InChI | InChI=1S/C15H11ClN4OS/c16-13-4-2-1-3-12(13)15-19-11(10-22-15)9-14(21)20(7-5-17)8-6-18/h1-4,10H,7-9H2 |
| InChIKey | WWPAVQHAQCTIHD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.80 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|