C19H16ClNO2S — CID 18291326
(2,6-dimethylphenyl) 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate (PubChem CID 18291326) has the molecular formula C19H16ClNO2S and a molecular weight of 357.86 g/mol. Its IUPAC name is (2,6-dimethylphenyl) 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate.
| Compound Name | (2,6-dimethylphenyl) 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
|---|---|
| PubChem CID | 18291326 |
| Molecular Formula | C19H16ClNO2S |
| Molecular Weight | 357.86 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | (2,6-dimethylphenyl) 2-[2-(4-chlorophenyl)-1,3-thiazol-4-yl]acetate |
| SMILES | Cc1cccc(C)c1OC(=O)Cc1csc(-c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C19H16ClNO2S/c1-12-4-3-5-13(2)18(12)23-17(22)10-16-11-24-19(21-16)14-6-8-15(20)9-7-14/h3-9,11H,10H2,1-2H3 |
| InChIKey | ARKOSTUUMDEELA-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.86 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|