C18H17NO2S2 — CID 16562698
(2,3,6-trimethylphenyl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 16562698) has the molecular formula C18H17NO2S2 and a molecular weight of 343.47 g/mol. Its IUPAC name is (2,3,6-trimethylphenyl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (2,3,6-trimethylphenyl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 16562698 |
| Molecular Formula | C18H17NO2S2 |
| Molecular Weight | 343.47 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (2,3,6-trimethylphenyl) 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | Cc1ccc(C)c(OC(=O)Cc2csc(-c3cccs3)n2)c1C |
| InChI | InChI=1S/C18H17NO2S2/c1-11-6-7-12(2)17(13(11)3)21-16(20)9-14-10-23-18(19-14)15-5-4-8-22-15/h4-8,10H,9H2,1-3H3 |
| InChIKey | UZIWKDDQXXGRQZ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.47 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|