C15H12N2O2S2 — CID 43021631
pyridin-2-ylmethyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 43021631) has the molecular formula C15H12N2O2S2 and a molecular weight of 316.41 g/mol. Its IUPAC name is pyridin-2-ylmethyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | pyridin-2-ylmethyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 43021631 |
| Molecular Formula | C15H12N2O2S2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.03 |
| IUPAC Name | pyridin-2-ylmethyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2cccs2)n1)OCc1ccccn1 |
| InChI | InChI=1S/C15H12N2O2S2/c18-14(19-9-11-4-1-2-6-16-11)8-12-10-21-15(17-12)13-5-3-7-20-13/h1-7,10H,8-9H2 |
| InChIKey | MMBLRPQQMZNTHE-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |