C17H12N2O2S2 — CID 27774879
(4-cyanophenyl)methyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate (PubChem CID 27774879) has the molecular formula C17H12N2O2S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is (4-cyanophenyl)methyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-cyanophenyl)methyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 27774879 |
| Molecular Formula | C17H12N2O2S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (4-cyanophenyl)methyl 2-(2-thiophen-2-yl-1,3-thiazol-4-yl)acetate |
| SMILES | N#Cc1ccc(COC(=O)Cc2csc(-c3cccs3)n2)cc1 |
| InChI | InChI=1S/C17H12N2O2S2/c18-9-12-3-5-13(6-4-12)10-21-16(20)8-14-11-23-17(19-14)15-2-1-7-22-15/h1-7,11H,8,10H2 |
| InChIKey | QHIVTODDJIAMIS-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |