C18H12N2O2S — CID 8765857
(4-cyanophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate (PubChem CID 8765857) has the molecular formula C18H12N2O2S and a molecular weight of 320.37 g/mol. Its IUPAC name is (4-cyanophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate.
| Compound Name | (4-cyanophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 8765857 |
| Molecular Formula | C18H12N2O2S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.06 |
| IUPAC Name | (4-cyanophenyl) 2-(2-phenyl-1,3-thiazol-4-yl)acetate |
| SMILES | N#Cc1ccc(OC(=O)Cc2csc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C18H12N2O2S/c19-11-13-6-8-16(9-7-13)22-17(21)10-15-12-23-18(20-15)14-4-2-1-3-5-14/h1-9,12H,10H2 |
| InChIKey | ZUHRBGLDIOVFCT-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 62.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|