C18H15NO4S2 — CID 18273893
methyl 2-[4-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]oxyphenyl]acetate (PubChem CID 18273893) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is methyl 2-[4-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]oxyphenyl]acetate.
| Compound Name | methyl 2-[4-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]oxyphenyl]acetate |
|---|---|
| PubChem CID | 18273893 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | methyl 2-[4-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]oxyphenyl]acetate |
| SMILES | COC(=O)Cc1ccc(OC(=O)Cc2csc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C18H15NO4S2/c1-22-16(20)8-12-2-4-15(5-3-12)23-17(21)9-14-11-25-18(19-14)13-6-7-24-10-13/h2-7,10-11H,8-9H2,1H3 |
| InChIKey | PTXZPKCNEQLEKL-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|