C10H10N2O2S2 — CID 51279391
N-methoxy-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 51279391) has the molecular formula C10H10N2O2S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is N-methoxy-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-methoxy-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 51279391 |
| Molecular Formula | C10H10N2O2S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.02 |
| IUPAC Name | N-methoxy-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CONC(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C10H10N2O2S2/c1-14-12-9(13)4-8-6-16-10(11-8)7-2-3-15-5-7/h2-3,5-6H,4H2,1H3,(H,12,13) |
| InChIKey | SVRWOMXMLMICPX-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|