C18H16N2O3S2 — CID 32982193
benzyl 2-[[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetate (PubChem CID 32982193) has the molecular formula C18H16N2O3S2 and a molecular weight of 372.47 g/mol. Its IUPAC name is benzyl 2-[[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetate.
| Compound Name | benzyl 2-[[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetate |
|---|---|
| PubChem CID | 32982193 |
| Molecular Formula | C18H16N2O3S2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.06 |
| IUPAC Name | benzyl 2-[[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]amino]acetate |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)NCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H16N2O3S2/c21-16(8-15-12-25-18(20-15)14-6-7-24-11-14)19-9-17(22)23-10-13-4-2-1-3-5-13/h1-7,11-12H,8-10H2,(H,19,21) |
| InChIKey | JKNLUXKAASKFTB-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |