C17H14N2O3S2 — CID 51238548
benzyl 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetate (PubChem CID 51238548) has the molecular formula C17H14N2O3S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is benzyl 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetate.
| Compound Name | benzyl 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 51238548 |
| Molecular Formula | C17H14N2O3S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | benzyl 2-[(2-thiophen-3-yl-1,3-thiazole-4-carbonyl)amino]acetate |
| SMILES | O=C(CNC(=O)c1csc(-c2ccsc2)n1)OCc1ccccc1 |
| InChI | InChI=1S/C17H14N2O3S2/c20-15(22-9-12-4-2-1-3-5-12)8-18-16(21)14-11-24-17(19-14)13-6-7-23-10-13/h1-7,10-11H,8-9H2,(H,18,21) |
| InChIKey | URGRFGAHIDTHIY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |