C10H10N2OS2 — CID 51229416
N-ethyl-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 51229416) has the molecular formula C10H10N2OS2 and a molecular weight of 238.34 g/mol. Its IUPAC name is N-ethyl-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-ethyl-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 51229416 |
| Molecular Formula | C10H10N2OS2 |
| Molecular Weight | 238.34 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | N-ethyl-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | CCNC(=O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C10H10N2OS2/c1-2-11-9(13)8-6-15-10(12-8)7-3-4-14-5-7/h3-6H,2H2,1H3,(H,11,13) |
| InChIKey | JDMFRZLTAQQYNI-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |