C10H11N3O3S3 — CID 56787733
N-(2-sulfamoylethyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 56787733) has the molecular formula C10H11N3O3S3 and a molecular weight of 317.42 g/mol. Its IUPAC name is N-(2-sulfamoylethyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(2-sulfamoylethyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 56787733 |
| Molecular Formula | C10H11N3O3S3 |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | N-(2-sulfamoylethyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | NS(=O)(=O)CCNC(=O)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C10H11N3O3S3/c11-19(15,16)4-2-12-9(14)8-6-18-10(13-8)7-1-3-17-5-7/h1,3,5-6H,2,4H2,(H,12,14)(H2,11,15,16) |
| InChIKey | SUTMGGZVQSECAX-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |