C14H14N4OS2 — CID 86911998
N-(3-imidazol-1-ylpropyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 86911998) has the molecular formula C14H14N4OS2 and a molecular weight of 318.43 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 86911998 |
| Molecular Formula | C14H14N4OS2 |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-thiophen-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C14H14N4OS2/c19-13(16-3-1-5-18-6-4-15-10-18)12-9-21-14(17-12)11-2-7-20-8-11/h2,4,6-10H,1,3,5H2,(H,16,19) |
| InChIKey | UKBMQJDFGZZHEJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|