C12H13N5OS — CID 56892018
N-(3-imidazol-1-ylpropyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide (PubChem CID 56892018) has the molecular formula C12H13N5OS and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
|---|---|
| PubChem CID | 56892018 |
| Molecular Formula | C12H13N5OS |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)imidazo[2,1-b][1,3]thiazole-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1cn2ccsc2n1 |
| InChI | InChI=1S/C12H13N5OS/c18-11(10-8-17-6-7-19-12(17)15-10)14-2-1-4-16-5-3-13-9-16/h3,5-9H,1-2,4H2,(H,14,18) |
| InChIKey | DHKXAZMNLMZFKD-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 64.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|