C15H17N5O2S2 — CID 126469570
7-ethylsulfanyl-N-(3-imidazol-1-ylpropyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide (PubChem CID 126469570) has the molecular formula C15H17N5O2S2 and a molecular weight of 363.47 g/mol. Its IUPAC name is 7-ethylsulfanyl-N-(3-imidazol-1-ylpropyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide.
| Compound Name | 7-ethylsulfanyl-N-(3-imidazol-1-ylpropyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 126469570 |
| Molecular Formula | C15H17N5O2S2 |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 7-ethylsulfanyl-N-(3-imidazol-1-ylpropyl)-5-oxo-[1,3]thiazolo[3,2-a]pyrimidine-6-carboxamide |
| SMILES | CCSc1nc2sccn2c(=O)c1C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C15H17N5O2S2/c1-2-23-13-11(14(22)20-8-9-24-15(20)18-13)12(21)17-4-3-6-19-7-5-16-10-19/h5,7-10H,2-4,6H2,1H3,(H,17,21) |
| InChIKey | HWHVSJVUEFJRNC-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 81.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|