C11H14N4OS — CID 47447578
N-(3-imidazol-1-ylpropyl)-2-methyl-1,3-thiazole-4-carboxamide (PubChem CID 47447578) has the molecular formula C11H14N4OS and a molecular weight of 250.33 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-methyl-1,3-thiazole-4-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-methyl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 47447578 |
| Molecular Formula | C11H14N4OS |
| Molecular Weight | 250.33 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-methyl-1,3-thiazole-4-carboxamide |
| SMILES | Cc1nc(C(=O)NCCCn2ccnc2)cs1 |
| InChI | InChI=1S/C11H14N4OS/c1-9-14-10(7-17-9)11(16)13-3-2-5-15-6-4-12-8-15/h4,6-8H,2-3,5H2,1H3,(H,13,16) |
| InChIKey | QRIAZFZMOIRLOO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.33 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|