C19H23N7O2 — CID 10177866
2-N,4-N-bis(3-imidazol-1-ylpropyl)pyridine-2,4-dicarboxamide (PubChem CID 10177866) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 2-N,4-N-bis(3-imidazol-1-ylpropyl)pyridine-2,4-dicarboxamide.
| Compound Name | 2-N,4-N-bis(3-imidazol-1-ylpropyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 10177866 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-N,4-N-bis(3-imidazol-1-ylpropyl)pyridine-2,4-dicarboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccnc(C(=O)NCCCn2ccnc2)c1 |
| InChI | InChI=1S/C19H23N7O2/c27-18(23-4-1-9-25-11-7-20-14-25)16-3-6-22-17(13-16)19(28)24-5-2-10-26-12-8-21-15-26/h3,6-8,11-15H,1-2,4-5,9-10H2,(H,23,27)(H,24,28) |
| InChIKey | XLJHTMIKAZOPCF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 106.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|