C15H16N6O — CID 77097246
N-(3-imidazol-1-ylpropyl)-3-(1,2,4-triazol-4-yl)benzamide (PubChem CID 77097246) has the molecular formula C15H16N6O and a molecular weight of 296.33 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-3-(1,2,4-triazol-4-yl)benzamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-3-(1,2,4-triazol-4-yl)benzamide |
|---|---|
| PubChem CID | 77097246 |
| Molecular Formula | C15H16N6O |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-3-(1,2,4-triazol-4-yl)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1cccc(-n2cnnc2)c1 |
| InChI | InChI=1S/C15H16N6O/c22-15(17-5-2-7-20-8-6-16-10-20)13-3-1-4-14(9-13)21-11-18-19-12-21/h1,3-4,6,8-12H,2,5,7H2,(H,17,22) |
| InChIKey | NFBSPPLBJDRKDP-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 77.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|