C21H31ClN3O- — CID 53352599
3,5-ditert-butyl-N-(3-imidazol-1-ylpropyl)benzamide chloride (PubChem CID 53352599) has the molecular formula C21H31ClN3O- and a molecular weight of 376.95 g/mol. Its IUPAC name is 3,5-ditert-butyl-N-(3-imidazol-1-ylpropyl)benzamide chloride.
| Compound Name | 3,5-ditert-butyl-N-(3-imidazol-1-ylpropyl)benzamide chloride |
|---|---|
| PubChem CID | 53352599 |
| Molecular Formula | C21H31ClN3O- |
| Molecular Weight | 376.95 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | 3,5-ditert-butyl-N-(3-imidazol-1-ylpropyl)benzamide chloride |
| SMILES | CC(C)(C)c1cc(C(=O)NCCCn2ccnc2)cc(C(C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C21H31N3O.ClH/c1-20(2,3)17-12-16(13-18(14-17)21(4,5)6)19(25)23-8-7-10-24-11-9-22-15-24;/h9,11-15H,7-8,10H2,1-6H3,(H,23,25);1H/p-1 |
| InChIKey | KZPSRVYOBFGNJM-UHFFFAOYSA-M |
| XLogP | 1.30 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.95 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|