C16H20N4O3S — CID 51328573
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-imidazol-1-ylpropyl)benzamide (PubChem CID 51328573) has the molecular formula C16H20N4O3S and a molecular weight of 348.43 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-imidazol-1-ylpropyl)benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-imidazol-1-ylpropyl)benzamide |
|---|---|
| PubChem CID | 51328573 |
| Molecular Formula | C16H20N4O3S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(3-imidazol-1-ylpropyl)benzamide |
| SMILES | O=C(NCCCn1ccnc1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C16H20N4O3S/c21-16(18-6-2-8-19-10-7-17-13-19)14-4-1-5-15(12-14)20-9-3-11-24(20,22)23/h1,4-5,7,10,12-13H,2-3,6,8-9,11H2,(H,18,21) |
| InChIKey | CPADUEPWPJTFFD-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|