C14H18N2O5S2 — CID 119241903
2-[2-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethylsulfanyl]acetic acid (PubChem CID 119241903) has the molecular formula C14H18N2O5S2 and a molecular weight of 358.44 g/mol. Its IUPAC name is 2-[2-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethylsulfanyl]acetic acid.
| Compound Name | 2-[2-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119241903 |
| Molecular Formula | C14H18N2O5S2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.07 |
| IUPAC Name | 2-[2-[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]ethylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCCNC(=O)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H18N2O5S2/c17-13(18)10-22-7-5-15-14(19)11-3-1-4-12(9-11)16-6-2-8-23(16,20)21/h1,3-4,9H,2,5-8,10H2,(H,15,19)(H,17,18) |
| InChIKey | JYDSIODTKNKESC-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|