C17H25N3O3S — CID 119558574
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-piperidin-3-ylethyl)benzamide (PubChem CID 119558574) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-piperidin-3-ylethyl)benzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-piperidin-3-ylethyl)benzamide |
|---|---|
| PubChem CID | 119558574 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-(2-piperidin-3-ylethyl)benzamide |
| SMILES | O=C(NCCC1CCCNC1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H25N3O3S/c21-17(19-9-7-14-4-2-8-18-13-14)15-5-1-6-16(12-15)20-10-3-11-24(20,22)23/h1,5-6,12,14,18H,2-4,7-11,13H2,(H,19,21) |
| InChIKey | XRXWKSSFFSMMLW-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |