C15H21N3O3S — CID 119428215
3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-piperidin-3-ylbenzamide (PubChem CID 119428215) has the molecular formula C15H21N3O3S and a molecular weight of 323.42 g/mol. Its IUPAC name is 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-piperidin-3-ylbenzamide.
| Compound Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-piperidin-3-ylbenzamide |
|---|---|
| PubChem CID | 119428215 |
| Molecular Formula | C15H21N3O3S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 3-(1,1-dioxo-1,2-thiazolidin-2-yl)-N-piperidin-3-ylbenzamide |
| SMILES | O=C(NC1CCCNC1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C15H21N3O3S/c19-15(17-13-5-2-7-16-11-13)12-4-1-6-14(10-12)18-8-3-9-22(18,20)21/h1,4,6,10,13,16H,2-3,5,7-9,11H2,(H,17,19) |
| InChIKey | WXAOSXKDEXWRFF-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |