C16H23N3O3S — CID 119478135
N-(4-aminocyclohexyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 119478135) has the molecular formula C16H23N3O3S and a molecular weight of 337.44 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(4-aminocyclohexyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 119478135 |
| Molecular Formula | C16H23N3O3S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.15 |
| IUPAC Name | N-(4-aminocyclohexyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | NC1CCC(NC(=O)c2cccc(N3CCCS3(=O)=O)c2)CC1 |
| InChI | InChI=1S/C16H23N3O3S/c17-13-5-7-14(8-6-13)18-16(20)12-3-1-4-15(11-12)19-9-2-10-23(19,21)22/h1,3-4,11,13-14H,2,5-10,17H2,(H,18,20) |
| InChIKey | SIEMAYYMJSNYRP-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |