C17H19N3O3S — CID 7659003
3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)benzamide (PubChem CID 7659003) has the molecular formula C17H19N3O3S and a molecular weight of 345.42 g/mol. Its IUPAC name is 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)benzamide.
| Compound Name | 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)benzamide |
|---|---|
| PubChem CID | 7659003 |
| Molecular Formula | C17H19N3O3S |
| Molecular Weight | 345.42 g/mol |
| Exact Mass | 345.11 |
| IUPAC Name | 3-(1,1-dioxothiazinan-2-yl)-N-(pyridin-4-ylmethyl)benzamide |
| SMILES | O=C(NCc1ccncc1)c1cccc(N2CCCCS2(=O)=O)c1 |
| InChI | InChI=1S/C17H19N3O3S/c21-17(19-13-14-6-8-18-9-7-14)15-4-3-5-16(12-15)20-10-1-2-11-24(20,22)23/h3-9,12H,1-2,10-11,13H2,(H,19,21) |
| InChIKey | FRZREIGUYDZZOF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.42 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |