C24H23N3O4S — CID 46475375
3-[[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]methyl]-N-phenylbenzamide (PubChem CID 46475375) has the molecular formula C24H23N3O4S and a molecular weight of 449.53 g/mol. Its IUPAC name is 3-[[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]methyl]-N-phenylbenzamide.
| Compound Name | 3-[[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]methyl]-N-phenylbenzamide |
|---|---|
| PubChem CID | 46475375 |
| Molecular Formula | C24H23N3O4S |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.14 |
| IUPAC Name | 3-[[[3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzoyl]amino]methyl]-N-phenylbenzamide |
| SMILES | O=C(NCc1cccc(C(=O)Nc2ccccc2)c1)c1cccc(N2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C24H23N3O4S/c28-23(20-9-5-12-22(16-20)27-13-6-14-32(27,30)31)25-17-18-7-4-8-19(15-18)24(29)26-21-10-2-1-3-11-21/h1-5,7-12,15-16H,6,13-14,17H2,(H,25,28)(H,26,29) |
| InChIKey | BSPPRSVSSTUZKS-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |