C17H15N3O3S — CID 18289205
N-(4-cyanophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide (PubChem CID 18289205) has the molecular formula C17H15N3O3S and a molecular weight of 341.39 g/mol. Its IUPAC name is N-(4-cyanophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide.
| Compound Name | N-(4-cyanophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
|---|---|
| PubChem CID | 18289205 |
| Molecular Formula | C17H15N3O3S |
| Molecular Weight | 341.39 g/mol |
| Exact Mass | 341.08 |
| IUPAC Name | N-(4-cyanophenyl)-3-(1,1-dioxo-1,2-thiazolidin-2-yl)benzamide |
| SMILES | N#Cc1ccc(NC(=O)c2cccc(N3CCCS3(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H15N3O3S/c18-12-13-5-7-15(8-6-13)19-17(21)14-3-1-4-16(11-14)20-9-2-10-24(20,22)23/h1,3-8,11H,2,9-10H2,(H,19,21) |
| InChIKey | YFPYJUOXIYXRDZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.39 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |