C12H20N4O2 — CID 565508
N-butyl-N'-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 565508) has the molecular formula C12H20N4O2 and a molecular weight of 252.32 g/mol. Its IUPAC name is N-butyl-N'-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N-butyl-N'-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 565508 |
| Molecular Formula | C12H20N4O2 |
| Molecular Weight | 252.32 g/mol |
| Exact Mass | 252.16 |
| IUPAC Name | N-butyl-N'-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | CCCCNC(=O)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C12H20N4O2/c1-2-3-5-14-11(17)12(18)15-6-4-8-16-9-7-13-10-16/h7,9-10H,2-6,8H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | RFGUZMMUIQZQLV-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.32 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|