C11H16N3OP — CID 143264856
(Z)-N-(3-imidazol-1-ylpropyl)-2-(phosphanylidenemethyl)but-2-enamide (PubChem CID 143264856) has the molecular formula C11H16N3OP and a molecular weight of 237.24 g/mol. Its IUPAC name is (Z)-N-(3-imidazol-1-ylpropyl)-2-(phosphanylidenemethyl)but-2-enamide.
| Compound Name | (Z)-N-(3-imidazol-1-ylpropyl)-2-(phosphanylidenemethyl)but-2-enamide |
|---|---|
| PubChem CID | 143264856 |
| Molecular Formula | C11H16N3OP |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (Z)-N-(3-imidazol-1-ylpropyl)-2-(phosphanylidenemethyl)but-2-enamide |
| SMILES | [H]/P=C/C(=C\C)C(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C11H16N3OP/c1-2-10(8-16)11(15)13-4-3-6-14-7-5-12-9-14/h2,5,7-9,16H,3-4,6H2,1H3,(H,13,15)/b10-2+ |
| InChIKey | IEAQTSWEFRUFMU-WTDSWWLTSA-N |
| XLogP | 1.28 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|