About acetic acid;1-decylimidazole
acetic acid;1-decylimidazole (PubChem CID 175546754) has the molecular formula C15H28N2O2
and a molecular weight of 268.40 g/mol. Its IUPAC name is acetic acid;1-decylimidazole.
Molecular Properties
| Compound Name | acetic acid;1-decylimidazole |
| PubChem CID | 175546754 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | acetic acid;1-decylimidazole |
| SMILES | CC(=O)O.CCCCCCCCCCn1ccnc1 |
| InChI | InChI=1S/C13H24N2.C2H4O2/c1-2-3-4-5-6-7-8-9-11-15-12-10-14-13-15;1-2(3)4/h10,12-13H,2-9,11H2,1H3;1H3,(H,3,4) |
| InChIKey | PTDAGZFLLYDMIJ-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;1-decylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;1-decylimidazole?
The IUPAC name of acetic acid;1-decylimidazole (CID 175546754) is acetic acid;1-decylimidazole.
What is the SMILES notation for acetic acid;1-decylimidazole?
The canonical SMILES for acetic acid;1-decylimidazole is CC(=O)O.CCCCCCCCCCn1ccnc1.
What is the InChIKey of acetic acid;1-decylimidazole?
The InChIKey is PTDAGZFLLYDMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2.C2H4O2/c1-2-3-4-5-6-7-8-9-11-15-12-10-14-13-15;1-2(3)4/h10,12-13H,2-9,11H2,1H3;1H3,(H,3,4).
What are the key properties of acetic acid;1-decylimidazole?
acetic acid;1-decylimidazole has a molecular weight of 268.40 g/mol, XLogP of 4.11, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;1-decylimidazole is sourced from PubChem (CID 175546754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).