About fluoroboronic acid;bis(1-pentylimidazole)
fluoroboronic acid;bis(1-pentylimidazole) (PubChem CID 173201251) has the molecular formula C16H30BFN4O2
and a molecular weight of 340.25 g/mol. Its IUPAC name is fluoroboronic acid;bis(1-pentylimidazole).
Molecular Properties
| Compound Name | fluoroboronic acid;bis(1-pentylimidazole) |
| PubChem CID | 173201251 |
| Molecular Formula | C16H30BFN4O2 |
| Molecular Weight | 340.25 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | fluoroboronic acid;bis(1-pentylimidazole) |
| SMILES | CCCCCn1ccnc1.CCCCCn1ccnc1.OB(O)F |
| InChI | InChI=1S/2C8H14N2.BFH2O2/c2*1-2-3-4-6-10-7-5-9-8-10;2-1(3)4/h2*5,7-8H,2-4,6H2,1H3;3-4H |
| InChIKey | FXRXXSHDTJDWIU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.25 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluoroboronic acid;bis(1-pentylimidazole) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoroboronic acid;bis(1-pentylimidazole)?
The IUPAC name of fluoroboronic acid;bis(1-pentylimidazole) (CID 173201251) is fluoroboronic acid;bis(1-pentylimidazole).
What is the SMILES notation for fluoroboronic acid;bis(1-pentylimidazole)?
The canonical SMILES for fluoroboronic acid;bis(1-pentylimidazole) is CCCCCn1ccnc1.CCCCCn1ccnc1.OB(O)F.
What is the InChIKey of fluoroboronic acid;bis(1-pentylimidazole)?
The InChIKey is FXRXXSHDTJDWIU-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H14N2.BFH2O2/c2*1-2-3-4-6-10-7-5-9-8-10;2-1(3)4/h2*5,7-8H,2-4,6H2,1H3;3-4H.
What are the key properties of fluoroboronic acid;bis(1-pentylimidazole)?
fluoroboronic acid;bis(1-pentylimidazole) has a molecular weight of 340.25 g/mol, XLogP of 3.07, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for fluoroboronic acid;bis(1-pentylimidazole) is sourced from PubChem (CID 173201251), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).