About 1-butylimidazole;hydron;hexafluorophosphate
1-butylimidazole;hydron;hexafluorophosphate (PubChem CID 174546653) has the molecular formula C7H13F6N2P
and a molecular weight of 270.16 g/mol. Its IUPAC name is 1-butylimidazole;hydron;hexafluorophosphate.
Molecular Properties
| Compound Name | 1-butylimidazole;hydron;hexafluorophosphate |
| PubChem CID | 174546653 |
| Molecular Formula | C7H13F6N2P |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 1-butylimidazole;hydron;hexafluorophosphate |
| SMILES | CCCCn1ccnc1.F[P-](F)(F)(F)(F)F.[H+] |
| InChI | InChI=1S/C7H12N2.F6P/c1-2-3-5-9-6-4-8-7-9;1-7(2,3,4,5)6/h4,6-7H,2-3,5H2,1H3;/q;-1/p+1 |
| InChIKey | ABADBCYGHJMNTB-UHFFFAOYSA-O |
| XLogP | 5.18 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-butylimidazole;hydron;hexafluorophosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butylimidazole;hydron;hexafluorophosphate?
The IUPAC name of 1-butylimidazole;hydron;hexafluorophosphate (CID 174546653) is 1-butylimidazole;hydron;hexafluorophosphate.
What is the SMILES notation for 1-butylimidazole;hydron;hexafluorophosphate?
The canonical SMILES for 1-butylimidazole;hydron;hexafluorophosphate is CCCCn1ccnc1.F[P-](F)(F)(F)(F)F.[H+].
What is the InChIKey of 1-butylimidazole;hydron;hexafluorophosphate?
The InChIKey is ABADBCYGHJMNTB-UHFFFAOYSA-O. The full InChI is InChI=1S/C7H12N2.F6P/c1-2-3-5-9-6-4-8-7-9;1-7(2,3,4,5)6/h4,6-7H,2-3,5H2,1H3;/q;-1/p+1.
What are the key properties of 1-butylimidazole;hydron;hexafluorophosphate?
1-butylimidazole;hydron;hexafluorophosphate has a molecular weight of 270.16 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butylimidazole;hydron;hexafluorophosphate is sourced from PubChem (CID 174546653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).