C14H15FN4O2 — CID 2883621
N'-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 2883621) has the molecular formula C14H15FN4O2 and a molecular weight of 290.30 g/mol. Its IUPAC name is N'-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 2883621 |
| Molecular Formula | C14H15FN4O2 |
| Molecular Weight | 290.30 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N'-(4-fluorophenyl)-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | O=C(NCCCn1ccnc1)C(=O)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C14H15FN4O2/c15-11-2-4-12(5-3-11)18-14(21)13(20)17-6-1-8-19-9-7-16-10-19/h2-5,7,9-10H,1,6,8H2,(H,17,20)(H,18,21) |
| InChIKey | JFJXKELSPXNJPL-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.30 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|