C12H14N6O4 — CID 42536590
N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(3-imidazol-1-ylpropyl)oxamide (PubChem CID 42536590) has the molecular formula C12H14N6O4 and a molecular weight of 306.28 g/mol. Its IUPAC name is N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(3-imidazol-1-ylpropyl)oxamide.
| Compound Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(3-imidazol-1-ylpropyl)oxamide |
|---|---|
| PubChem CID | 42536590 |
| Molecular Formula | C12H14N6O4 |
| Molecular Weight | 306.28 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | N'-(2,4-dioxo-1H-pyrimidin-5-yl)-N-(3-imidazol-1-ylpropyl)oxamide |
| SMILES | O=C(NCCCn1ccnc1)C(=O)Nc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H14N6O4/c19-9-8(6-15-12(22)17-9)16-11(21)10(20)14-2-1-4-18-5-3-13-7-18/h3,5-7H,1-2,4H2,(H,14,20)(H,16,21)(H2,15,17,19,22) |
| InChIKey | IHDOACFEMFCPAJ-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 141.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.28 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|