C10H14N3O3- — CID 7009162
4-(3-imidazol-1-ylpropylamino)-4-oxobutanoate (PubChem CID 7009162) has the molecular formula C10H14N3O3- and a molecular weight of 224.24 g/mol. Its IUPAC name is 4-(3-imidazol-1-ylpropylamino)-4-oxobutanoate.
| Compound Name | 4-(3-imidazol-1-ylpropylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 7009162 |
| Molecular Formula | C10H14N3O3- |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(3-imidazol-1-ylpropylamino)-4-oxobutanoate |
| SMILES | O=C([O-])CCC(=O)NCCCn1ccnc1 |
| InChI | InChI=1S/C10H15N3O3/c14-9(2-3-10(15)16)12-4-1-6-13-7-5-11-8-13/h5,7-8H,1-4,6H2,(H,12,14)(H,15,16)/p-1 |
| InChIKey | WQCGNDJXYQJJSZ-UHFFFAOYSA-M |
| XLogP | -1.08 |
| TPSA | 87.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|