C9H15Cl2N3O — CID 146083026
2-chloro-N-(4-imidazol-1-ylbutyl)acetamide;hydrochloride (PubChem CID 146083026) has the molecular formula C9H15Cl2N3O and a molecular weight of 252.14 g/mol. Its IUPAC name is 2-chloro-N-(4-imidazol-1-ylbutyl)acetamide;hydrochloride.
| Compound Name | 2-chloro-N-(4-imidazol-1-ylbutyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 146083026 |
| Molecular Formula | C9H15Cl2N3O |
| Molecular Weight | 252.14 g/mol |
| Exact Mass | 251.06 |
| IUPAC Name | 2-chloro-N-(4-imidazol-1-ylbutyl)acetamide;hydrochloride |
| SMILES | Cl.O=C(CCl)NCCCCn1ccnc1 |
| InChI | InChI=1S/C9H14ClN3O.ClH/c10-7-9(14)12-3-1-2-5-13-6-4-11-8-13;/h4,6,8H,1-3,5,7H2,(H,12,14);1H |
| InChIKey | FYEOOESRHUSSNE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.14 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|