C11H16F3N3O — CID 110443177
2,2,2-trifluoro-N-(6-imidazol-1-ylhexyl)acetamide (PubChem CID 110443177) has the molecular formula C11H16F3N3O and a molecular weight of 263.26 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(6-imidazol-1-ylhexyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(6-imidazol-1-ylhexyl)acetamide |
|---|---|
| PubChem CID | 110443177 |
| Molecular Formula | C11H16F3N3O |
| Molecular Weight | 263.26 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 2,2,2-trifluoro-N-(6-imidazol-1-ylhexyl)acetamide |
| SMILES | O=C(NCCCCCCn1ccnc1)C(F)(F)F |
| InChI | InChI=1S/C11H16F3N3O/c12-11(13,14)10(18)16-5-3-1-2-4-7-17-8-6-15-9-17/h6,8-9H,1-5,7H2,(H,16,18) |
| InChIKey | MPXUVMXAHIFCGH-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.26 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|