C13H23N3O — CID 110442138
N-(5-imidazol-1-ylpentyl)-3-methylbutanamide (PubChem CID 110442138) has the molecular formula C13H23N3O and a molecular weight of 237.35 g/mol. Its IUPAC name is N-(5-imidazol-1-ylpentyl)-3-methylbutanamide.
| Compound Name | N-(5-imidazol-1-ylpentyl)-3-methylbutanamide |
|---|---|
| PubChem CID | 110442138 |
| Molecular Formula | C13H23N3O |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.18 |
| IUPAC Name | N-(5-imidazol-1-ylpentyl)-3-methylbutanamide |
| SMILES | CC(C)CC(=O)NCCCCCn1ccnc1 |
| InChI | InChI=1S/C13H23N3O/c1-12(2)10-13(17)15-6-4-3-5-8-16-9-7-14-11-16/h7,9,11-12H,3-6,8,10H2,1-2H3,(H,15,17) |
| InChIKey | QWVOQORQJMVMBI-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|