C11H20N4O2 — CID 79478466
2-(2-aminoethoxy)-N-(4-imidazol-1-ylbutyl)acetamide (PubChem CID 79478466) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-N-(4-imidazol-1-ylbutyl)acetamide.
| Compound Name | 2-(2-aminoethoxy)-N-(4-imidazol-1-ylbutyl)acetamide |
|---|---|
| PubChem CID | 79478466 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 2-(2-aminoethoxy)-N-(4-imidazol-1-ylbutyl)acetamide |
| SMILES | NCCOCC(=O)NCCCCn1ccnc1 |
| InChI | InChI=1S/C11H20N4O2/c12-3-8-17-9-11(16)14-4-1-2-6-15-7-5-13-10-15/h5,7,10H,1-4,6,8-9,12H2,(H,14,16) |
| InChIKey | VCOYVXJTFZXLQV-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 82.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|